N-Me-2-HPEA
2-[2-(Methylamino)ethyl]phenol
 6073 C9H13NO 151.206
 InChI=1S/C9H13NO/c1-10-7-6-8-4-2-3-5-9(8)11/h2-5,10-11H,6-7H2,1H3
 RZPBKCYWYVZAOJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1ccccc1O