homo-Dopamine
4-(3-Aminopropyl)benzene-1,2-diol
 607 C9H13NO2 167.205
 InChI=1S/C9H13NO2/c10-5-1-2-7-3-4-8(11)9(12)6-7/h3-4,6,11-12H,1-2,5,10H2
 JDMNLLVJYLMTPE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCCc1ccc(c(c1)O)O