BAP
2-(Butylamino)-1-phenylpropan-1-one
 6053 C13H19NO 205.296
 InChI=1S/C13H19NO/c1-3-4-10-14-11(2)13(15)12-8-6-5-7-9-12/h5-9,11,14H,3-4,10H2,1-2H3
 SFTGFCDNBIIGBP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCNC(C(=O)c1ccccc1)C