DO2OxolaneM
1-{2,5-Dimethoxy-4-[(oxolan-2-yl)methyl]phenyl}propan-2-amine
 5992  C16H25NO3  279.375
 InChI=1S/C16H25NO3/c1-11(17)7-12-9-16(19-3)13(10-15(12)18-2)8-14-5-4-6-20-14/h9-11,14H,4-8,17H2,1-3H3
 CHOZVNZOEBJGKA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)c(cc1CC1CCCO1)OC