DOMeOMeSEt
1-(2,5-Dimethoxy-4-{2-[(methoxymethyl)sulfanyl]ethyl}phenyl)propan-2-amine
 5987  C15H25NO3S  299.429
 InChI=1S/C15H25NO3S/c1-11(16)7-13-9-14(18-3)12(8-15(13)19-4)5-6-20-10-17-2/h8-9,11H,5-7,10,16H2,1-4H3
 MYPDSIYOEDUSHL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COCSCCc1cc(OC)c(cc1OC)CC(N)C