N-Pr-2,5-DMA
N-[1-(2,5-Dimethoxyphenyl)propan-2-yl]propan-1-amine
 5980 C14H23NO2 237.338
 InChI=1S/C14H23NO2/c1-5-8-15-11(2)9-12-10-13(16-3)6-7-14(12)17-4/h6-7,10-11,15H,5,8-9H2,1-4H3
 MWVQFQMMUNRMDO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCNC(Cc1cc(OC)ccc1OC)C