4C-D-2,5-DIETO
1-(2,5-Diethoxy-4-methylphenyl)butan-2-amine
 598 C15H25NO2 251.365
 InChI=1S/C15H25NO2/c1-5-13(16)9-12-10-14(17-6-2)11(4)8-15(12)18-7-3/h8,10,13H,5-7,9,16H2,1-4H3
 AARZZQUBVFWMJH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(C)c(cc1CC(CC)N)OCC