2-DM-DOB
2-(2-Aminopropyl)-5-bromo-4-methoxyphenol
 5978 C10H14BrNO2 260.128
 InChI=1S/C10H14BrNO2/c1-6(12)3-7-4-10(14-2)8(11)5-9(7)13/h4-6,13H,3,12H2,1-2H3
 YMEPEWSDHUFKSX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)c(cc1Br)O