Ethyl 3-(2-aminoethyl)-1H-indole-5-carboxylate
 5899  C13H16N2O2  232.278
 InChI=1S/C13H16N2O2/c1-2-17-13(16)9-3-4-12-11(7-9)10(5-6-14)8-15-12/h3-4,7-8,15H,2,5-6,14H2,1H3
 RFPSMDQRWIJYQK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c[nH]c2c1cc(cc2)C(=O)OCC