5-BnO-DET
2-[5-(Benzyloxy)-1H-indol-3-yl]-N,N-diethylethan-1-amine
 5872 C21H26N2O 322.444
 InChI=1S/C21H26N2O/c1-3-23(4-2)13-12-18-15-22-21-11-10-19(14-20(18)21)24-16-17-8-6-5-7-9-17/h5-11,14-15,22H,3-4,12-13,16H2,1-2H3
 YQRJJFOVHJALDC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(CCc1c[nH]c2c1cc(OCc1ccccc1)cc2)CC