5-HeO-NMT
2-[5-(Hexyloxy)-1H-indol-3-yl]-N-methylethan-1-amine
 5863  C17H26N2O  274.401
 InChI=1S/C17H26N2O/c1-3-4-5-6-11-20-15-7-8-17-16(12-15)14(13-19-17)9-10-18-2/h7-8,12-13,18-19H,3-6,9-11H2,1-2H3
 YAUPVUHPFUVZMN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCCOc1ccc2c(c1)c(CCNC)c[nH]2