5-PeO-NMT
N-Methyl-2-[5-(pentyloxy)-1H-indol-3-yl]ethan-1-amine
 5862  C16H24N2O  260.375
 InChI=1S/C16H24N2O/c1-3-4-5-10-19-14-6-7-16-15(11-14)13(12-18-16)8-9-17-2/h6-7,11-12,17-18H,3-5,8-10H2,1-2H3
 SYSKEKYINWMCEU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCOc1ccc2c(c1)c(CCNC)c[nH]2