5-PrO-NMT
N-Methyl-2-(5-propoxy-1H-indol-3-yl)ethan-1-amine
 5860 C14H20N2O 232.321
 InChI=1S/C14H20N2O/c1-3-8-17-12-4-5-14-13(9-12)11(10-16-14)6-7-15-2/h4-5,9-10,15-16H,3,6-8H2,1-2H3
 PIBGHIUMDRKMBE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCOc1ccc2c(c1)c(CCNC)c[nH]2