5-EtO-NMT
2-(5-Ethoxy-1H-indol-3-yl)-N-methylethan-1-amine
 5859  C13H18N2O  218.295
 InChI=1S/C13H18N2O/c1-3-16-11-4-5-13-12(8-11)10(9-15-13)6-7-14-2/h4-5,8-9,14-15H,3,6-7H2,1-2H3
 OJYLRVHEILMFSU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1c[nH]c2c1cc(OCC)cc2