5-CPeO-T
2-[5-(Cyclopentyloxy)-1H-indol-3-yl]ethan-1-amine
 5855  C15H20N2O  244.332
 InChI=1S/C15H20N2O/c16-8-7-11-10-17-15-6-5-13(9-14(11)15)18-12-3-1-2-4-12/h5-6,9-10,12,17H,1-4,7-8,16H2
 NHZOONYTVFHREF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c[nH]c2c1cc(OC1CCCC1)cc2