5-HeO-T
2-[5-(Hexyloxy)-1H-indol-3-yl]ethan-1-amine
 5854  C16H24N2O  260.375
 InChI=1S/C16H24N2O/c1-2-3-4-5-10-19-14-6-7-16-15(11-14)13(8-9-17)12-18-16/h6-7,11-12,18H,2-5,8-10,17H2,1H3
 WZYQAUSPXHOGSM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCCOc1ccc2c(c1)c(CCN)c[nH]2