5-PrO-T
2-(5-Propoxy-1H-indol-3-yl)ethan-1-amine
 5851  C13H18N2O  218.295
 InChI=1S/C13H18N2O/c1-2-7-16-11-3-4-13-12(8-11)10(5-6-14)9-15-13/h3-4,8-9,15H,2,5-7,14H2,1H3
 SXHSCDTUUHPMSY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCOc1ccc2c(c1)c(CCN)c[nH]2