N-{1-[5-(Benzyloxy)-1H-indol-3-yl]propan-2-yl}-N-propylpropan-1-amine
 5837  C24H32N2O  364.524
 InChI=1S/C24H32N2O/c1-4-13-26(14-5-2)19(3)15-21-17-25-24-12-11-22(16-23(21)24)27-18-20-9-7-6-8-10-20/h6-12,16-17,19,25H,4-5,13-15,18H2,1-3H3
 CGFUZVLHPPGGKQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(C(Cc1c[nH]c2c1cc(OCc1ccccc1)cc2)C)CCC