1-[5-(Benzyloxy)-1H-indol-3-yl]-N,N-diethylpropan-2-amine
 5836 C22H28N2O 336.471
 InChI=1S/C22H28N2O/c1-4-24(5-2)17(3)13-19-15-23-22-12-11-20(14-21(19)22)25-16-18-9-7-6-8-10-18/h6-12,14-15,17,23H,4-5,13,16H2,1-3H3
 MNEMFARDERMDTD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(C(Cc1c[nH]c2c1cc(OCc1ccccc1)cc2)C)CC