1-[5-(Benzyloxy)-1H-indol-3-yl]-N-(propan-2-yl)propan-2-amine
 5834 C21H26N2O 322.444
 InChI=1S/C21H26N2O/c1-15(2)23-16(3)11-18-13-22-21-10-9-19(12-20(18)21)24-14-17-7-5-4-6-8-17/h4-10,12-13,15-16,22-23H,11,14H2,1-3H3
 DIMLVHKCRMVWAM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NC(Cc1c[nH]c2c1cc(OCc1ccccc1)cc2)C)C