N-{1-[5-(Benzyloxy)-1H-indol-3-yl]propan-2-yl}propan-1-amine
 5833 C21H26N2O 322.444
 InChI=1S/C21H26N2O/c1-3-11-22-16(2)12-18-14-23-21-10-9-19(13-20(18)21)24-15-17-7-5-4-6-8-17/h4-10,13-14,16,22-23H,3,11-12,15H2,1-2H3
 JXFIBKBZLGHGOT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCNC(Cc1c[nH]c2c1cc(OCc1ccccc1)cc2)C