BDE
1-(4-Bromobenzo[1,2-b:5,4-b′]difuran-8-yl)propan-2-amine
 581 C13H12BrNO2 294.144
 InChI=1S/C13H12BrNO2/c1-7(15)6-10-12-8(2-4-16-12)11(14)9-3-5-17-13(9)10/h2-5,7H,6,15H2,1H3
 QKESKIUJFDPCKZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c2occc2c(c2c1occ2)Br)N