1-Methylbufotenine
3-[2-(Dimethylamino)ethyl]-1-methyl-1H-indol-5-ol
 5796  C13H18N2O  218.295
 InChI=1S/C13H18N2O/c1-14(2)7-6-10-9-15(3)13-5-4-11(16)8-12(10)13/h4-5,8-9,16H,6-7H2,1-3H3
 MRSBJIAZTHGJAP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1cn(c2c1cc(O)cc2)C)C