5,6,7-Trimethyl-DMT
N,N-Dimethyl-2-(5,6,7-trimethyl-1H-indol-3-yl)ethan-1-amine
 5795  C15H22N2  230.349
 InChI=1S/C15H22N2/c1-10-8-14-13(6-7-17(4)5)9-16-15(14)12(3)11(10)2/h8-9,16H,6-7H2,1-5H3
 ARDGMNIVKLGNMX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1c[nH]c2c1cc(C)c(c2C)C)C