5-MeO-1-Pr-DMT
2-(5-Methoxy-1-propyl-1H-indol-3-yl)-N,N-dimethylethan-1-amine
 5767  C16H24N2O  260.375
 InChI=1S/C16H24N2O/c1-5-9-18-12-13(8-10-17(2)3)15-11-14(19-4)6-7-16(15)18/h6-7,11-12H,5,8-10H2,1-4H3
 FEIKMSDMCKNQCS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCn1cc(c2c1ccc(c2)OC)CCN(C)C