5-MeO-1-Me-DMT
2-(5-Methoxy-1-methyl-1H-indol-3-yl)-N,N-dimethylethan-1-amine
 5765 C14H20N2O 232.321
 InChI=1S/C14H20N2O/c1-15(2)8-7-11-10-16(3)14-6-5-12(17-4)9-13(11)14/h5-6,9-10H,7-8H2,1-4H3
 GMYGWDMDFAGPPB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)c(CCN(C)C)cn2C