5-MeO-2-Pr-DMT
2-(5-Methoxy-2-propyl-1H-indol-3-yl)-N,N-dimethylethan-1-amine
 5764  C16H24N2O  260.375
 InChI=1S/C16H24N2O/c1-5-6-15-13(9-10-18(2)3)14-11-12(19-4)7-8-16(14)17-15/h7-8,11,17H,5-6,9-10H2,1-4H3
 BCOTUUNTPYJFKB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCc1[nH]c2c(c1CCN(C)C)cc(cc2)OC