HOT-T
N-Hydroxy-1-(1H-indol-3-yl)propan-2-amine
 5743  C11H14N2O  190.242
 InChI=1S/C11H14N2O/c1-8(13-14)6-9-7-12-11-5-3-2-4-10(9)11/h2-5,7-8,12-14H,6H2,1H3
 QDEFFOYILHFBSE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 ONC(Cc1c[nH]c2c1cccc2)C