N-Ethylhomotryptamine
N-Ethyl-3-(1H-indol-3-yl)propan-1-amine
 5741 C13H18N2 202.295
 InChI=1S/C13H18N2/c1-2-14-9-5-6-11-10-15-13-8-4-3-7-12(11)13/h3-4,7-8,10,14-15H,2,5-6,9H2,1H3
 MNTOEPBCNYRBCE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNCCCc1c[nH]c2c1cccc2