6-HO-T
3-(2-Aminoethyl)-1H-indol-6-ol
 5738 C10H12N2O 176.215
 InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-5-8(13)1-2-9(7)10/h1-2,5-6,12-13H,3-4,11H2
 WZTKTNRVJAMKAS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c[nH]c2c1ccc(c2)O