5-F-DET
N,N-Diethyl-2-(5-fluoro-1H-indol-3-yl)ethan-1-amine
 5737  C14H19FN2  234.312
 InChI=1S/C14H19FN2/c1-3-17(4-2)8-7-11-10-16-14-6-5-12(15)9-13(11)14/h5-6,9-10,16H,3-4,7-8H2,1-2H3
 LBJIPBJDJFZKIQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(CCc1c[nH]c2c1cc(F)cc2)CC