4F-DET
N,N-Diethyl-2-(4-fluoro-1H-indol-3-yl)ethan-1-amine
 5734  C14H19FN2  234.312
 InChI=1S/C14H19FN2/c1-3-17(4-2)9-8-11-10-16-13-7-5-6-12(15)14(11)13/h5-7,10,16H,3-4,8-9H2,1-2H3
 NVTRMYJKUWZPNN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(CCc1c[nH]c2c1c(F)ccc2)CC