2-Ethyl-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-N-methylbutan-1-amine
 5694  C18H28N2O  288.428
 InChI=1S/C18H28N2O/c1-5-14(6-2)13-20(3)10-9-15-12-19-18-8-7-16(21-4)11-17(15)18/h7-8,11-12,14,19H,5-6,9-10,13H2,1-4H3
 DRQUADANVCVSNM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(CN(CCc1c[nH]c2c1cc(OC)cc2)C)CC