N-[2-(5-Methoxy-1H-indol-3-yl)ethyl]-N-methylpentan-1-amine
 5686  C17H26N2O  274.401
 InChI=1S/C17H26N2O/c1-4-5-6-10-19(2)11-9-14-13-18-17-8-7-15(20-3)12-16(14)17/h7-8,12-13,18H,4-6,9-11H2,1-3H3
 YSLSTFPGMGOQRJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCN(CCc1c[nH]c2c1cc(OC)cc2)C