N-[2-(5-Methoxy-1H-indol-3-yl)ethyl]-N-methyl-4-phenylbutan-1-amine
 5683 C22H28N2O 336.471
 InChI=1S/C22H28N2O/c1-24(14-7-6-10-18-8-4-3-5-9-18)15-13-19-17-23-22-12-11-20(25-2)16-21(19)22/h3-5,8-9,11-12,16-17,23H,6-7,10,13-15H2,1-2H3
 LRWVRZYPLXOCLF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)c(CCN(CCCCc1ccccc1)C)c[nH]2