N-[2-(5-Methoxy-1H-indol-3-yl)ethyl]-N-methyl-3-phenylpropan-1-amine
 5681 C21H26N2O 322.444
 InChI=1S/C21H26N2O/c1-23(13-6-9-17-7-4-3-5-8-17)14-12-18-16-22-21-11-10-19(24-2)15-20(18)21/h3-5,7-8,10-11,15-16,22H,6,9,12-14H2,1-2H3
 AXAUOLBKOXMYBI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)c(CCN(CCCc1ccccc1)C)c[nH]2