2-(5-Methoxy-1H-indol-3-yl)-N-methyl-N-[2-(4-methylphenyl)ethyl]ethan-1-amine
 5672 C21H26N2O 322.444
 InChI=1S/C21H26N2O/c1-16-4-6-17(7-5-16)10-12-23(2)13-11-18-15-22-21-9-8-19(24-3)14-20(18)21/h4-9,14-15,22H,10-13H2,1-3H3
 YEMRBWYJVRLSCG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)c(CCN(CCc1ccc(cc1)C)C)c[nH]2