2-(3,5-Dimethylphenyl)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-N-methylethan-1-amine
 5669 C22H28N2O 336.471
 InChI=1S/C22H28N2O/c1-16-11-17(2)13-18(12-16)7-9-24(3)10-8-19-15-23-22-6-5-20(25-4)14-21(19)22/h5-6,11-15,23H,7-10H2,1-4H3
 LSVKESAZNYDEER-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)c(CCN(CCc1cc(C)cc(c1)C)C)c[nH]2