2-(5-Methoxy-1H-indol-3-yl)-N-methyl-N-[2-(3-methylphenyl)ethyl]ethan-1-amine
 5666 C21H26N2O 322.444
 InChI=1S/C21H26N2O/c1-16-5-4-6-17(13-16)9-11-23(2)12-10-18-15-22-21-8-7-19(24-3)14-20(18)21/h4-8,13-15,22H,9-12H2,1-3H3
 JYMJFHWTGDXUJF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)c(CCN(CCc1cccc(c1)C)C)c[nH]2