2-(2,5-Dimethylphenyl)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-N-methylethan-1-amine
 5663 C22H28N2O 336.471
 InChI=1S/C22H28N2O/c1-16-5-6-17(2)18(13-16)9-11-24(3)12-10-19-15-23-22-8-7-20(25-4)14-21(19)22/h5-8,13-15,23H,9-12H2,1-4H3
 RUBADSSLLZPSSG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)c(CCN(CCc1cc(C)ccc1C)C)c[nH]2