2-{[2-(1H-Indol-3-yl)ethyl](methyl)amino}ethyl acetate
 5654  C15H20N2O2  260.332
 InChI=1S/C15H20N2O2/c1-12(18)19-10-9-17(2)8-7-13-11-16-15-6-4-3-5-14(13)15/h3-6,11,16H,7-10H2,1-2H3
 NGYRPKJDYAJVFJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1c[nH]c2c1cccc2)CCOC(=O)C