N-[2-(1H-Indol-3-yl)ethyl]-N-methylprop-2-yn-1-amine
 5647 C14H16N2 212.29
 InChI=1S/C14H16N2/c1-3-9-16(2)10-8-12-11-15-14-7-5-4-6-13(12)14/h1,4-7,11,15H,8-10H2,2H3
 VHDFVGYDYUFWEY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C#CCN(CCc1c[nH]c2c1cccc2)C