2-Ethyl-N-[2-(1H-indol-3-yl)ethyl]-N-methylbutan-1-amine
 5645  C17H26N2  258.402
 InChI=1S/C17H26N2/c1-4-14(5-2)13-19(3)11-10-15-12-18-17-9-7-6-8-16(15)17/h6-9,12,14,18H,4-5,10-11,13H2,1-3H3
 IQNCFANRDPMJAO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(CN(CCc1c[nH]c2c1cccc2)C)CC