N-[2-(1H-Indol-3-yl)ethyl]-N-methylhexan-1-amine
 5635  C17H26N2  258.402
 InChI=1S/C17H26N2/c1-3-4-5-8-12-19(2)13-11-15-14-18-17-10-7-6-9-16(15)17/h6-7,9-10,14,18H,3-5,8,11-13H2,1-2H3
 GIRXPGMUAQWECH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCCN(CCc1c[nH]c2c1cccc2)C