2-(1H-Indol-3-yl)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-N-methylethan-1-amine
 5627  C22H25N3O  347.453
 InChI=1S/C22H25N3O/c1-25(11-9-16-14-23-21-6-4-3-5-19(16)21)12-10-17-15-24-22-8-7-18(26-2)13-20(17)22/h3-8,13-15,23-24H,9-12H2,1-2H3
 PLLDTQXECIBZDT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)c(CCN(CCc1c[nH]c3c1cccc3)C)c[nH]2