5-EtO-EIPT
N-[2-(5-Ethoxy-1H-indol-3-yl)ethyl]-N-ethylpropan-2-amine
 5591  C17H26N2O  274.401
 InChI=1S/C17H26N2O/c1-5-19(13(3)4)10-9-14-12-18-17-8-7-15(20-6-2)11-16(14)17/h7-8,11-13,18H,5-6,9-10H2,1-4H3
 PEACSMHHYVUVNO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccc2c(c1)c(CCN(C(C)C)CC)c[nH]2