5-EtO-MIPT
N-[2-(5-Ethoxy-1H-indol-3-yl)ethyl]-N-methylpropan-2-amine
 5590  C16H24N2O  260.375
 InChI=1S/C16H24N2O/c1-5-19-14-6-7-16-15(10-14)13(11-17-16)8-9-18(4)12(2)3/h6-7,10-12,17H,5,8-9H2,1-4H3
 HELWGYFZJADOHC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccc2c(c1)c(CCN(C(C)C)C)c[nH]2