5-EtO-MPT
N-[2-(5-Ethoxy-1H-indol-3-yl)ethyl]-N-methylpropan-1-amine
 5589  C16H24N2O  260.375
 InChI=1S/C16H24N2O/c1-4-9-18(3)10-8-13-12-17-16-7-6-14(19-5-2)11-15(13)16/h6-7,11-12,17H,4-5,8-10H2,1-3H3
 VDCNZSHVNHWVMV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(CCc1c[nH]c2c1cc(OCC)cc2)C