5-EtO-DIPT
N-[2-(5-Ethoxy-1H-indol-3-yl)ethyl]-N-(propan-2-yl)propan-2-amine
 5587  C18H28N2O  288.428
 InChI=1S/C18H28N2O/c1-6-21-16-7-8-18-17(11-16)15(12-19-18)9-10-20(13(2)3)14(4)5/h7-8,11-14,19H,6,9-10H2,1-5H3
 GKEIBYXMIDYZJG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccc2c(c1)c(CCN(C(C)C)C(C)C)c[nH]2