5-EtO-DPT
N-[2-(5-Ethoxy-1H-indol-3-yl)ethyl]-N-propylpropan-1-amine
 5586  C18H28N2O  288.428
 InChI=1S/C18H28N2O/c1-4-10-20(11-5-2)12-9-15-14-19-18-8-7-16(21-6-3)13-17(15)18/h7-8,13-14,19H,4-6,9-12H2,1-3H3
 COGBUYYMZBGFLA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(CCc1c[nH]c2c1cc(OCC)cc2)CCC